C22H44O3Si — CID 134863688
[(E,2S)-2-methyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-3-enoxy]-tri(propan-2-yl)silane (PubChem CID 134863688) has the molecular formula C22H44O3Si and a molecular weight of 384.68 g/mol. Its IUPAC name is [(E,2S)-2-methyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-3-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(E,2S)-2-methyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-3-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134863688 |
| Molecular Formula | C22H44O3Si |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | [(E,2S)-2-methyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-3-enoxy]-tri(propan-2-yl)silane |
| SMILES | C/C(=C\[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1OC(C)(C)OC[C@H]1C |
| InChI | InChI=1S/C22H44O3Si/c1-15(2)26(16(3)4,17(5)6)24-13-18(7)12-19(8)21-20(9)14-23-22(10,11)25-21/h12,15-18,20-21H,13-14H2,1-11H3/b19-12+/t18-,20+,21-/m0/s1 |
| InChIKey | JFCHFMSAXQONJO-GZFKDDIDSA-N |
| XLogP | 6.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|