C31H62O4Si2 — CID 53329190
tert-butyl-[(1R,2R,3E,6Z)-1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,4,6-trimethyl-8-(oxan-2-yloxy)octa-3,6-dienoxy]-dimethylsilane (PubChem CID 53329190) has the molecular formula C31H62O4Si2 and a molecular weight of 555.01 g/mol. Its IUPAC name is tert-butyl-[(1R,2R,3E,6Z)-1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,4,6-trimethyl-8-(oxan-2-yloxy)octa-3,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2R,3E,6Z)-1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,4,6-trimethyl-8-(oxan-2-yloxy)octa-3,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 53329190 |
| Molecular Formula | C31H62O4Si2 |
| Molecular Weight | 555.01 g/mol |
| Exact Mass | 554.42 |
| IUPAC Name | tert-butyl-[(1R,2R,3E,6Z)-1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,4,6-trimethyl-8-(oxan-2-yloxy)octa-3,6-dienoxy]-dimethylsilane |
| SMILES | C/C(=C/COC1CCCCO1)C/C(C)=C/[C@@H](C)[C@@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H62O4Si2/c1-24(18-20-33-29-17-15-16-19-32-29)21-25(2)22-26(3)28(35-37(13,14)31(8,9)10)23-27(4)34-36(11,12)30(5,6)7/h18,22,26-29H,15-17,19-21,23H2,1-14H3/b24-18-,25-22+/t26-,27-,28-,29?/m1/s1 |
| InChIKey | ZLMLGOPROWOSCV-VQJRICHASA-N |
| XLogP | 9.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.01 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|