C28H56O6Si2 — CID 70624910
3-[(2R,3S,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-4-trimethylsilyloxyoxan-3-yl]propoxy-trimethylsilane (PubChem CID 70624910) has the molecular formula C28H56O6Si2 and a molecular weight of 544.92 g/mol. Its IUPAC name is 3-[(2R,3S,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-4-trimethylsilyloxyoxan-3-yl]propoxy-trimethylsilane.
| Compound Name | 3-[(2R,3S,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-4-trimethylsilyloxyoxan-3-yl]propoxy-trimethylsilane |
|---|---|
| PubChem CID | 70624910 |
| Molecular Formula | C28H56O6Si2 |
| Molecular Weight | 544.92 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | 3-[(2R,3S,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-4-trimethylsilyloxyoxan-3-yl]propoxy-trimethylsilane |
| SMILES | CCCCCC(C=C[C@H]1O[C@@H](OC)C[C@@H](O[Si](C)(C)C)[C@H]1CCCO[Si](C)(C)C)OC1CCCCO1 |
| InChI | InChI=1S/C28H56O6Si2/c1-9-10-11-15-23(32-27-17-12-13-20-30-27)18-19-25-24(16-14-21-31-35(3,4)5)26(34-36(6,7)8)22-28(29-2)33-25/h18-19,23-28H,9-17,20-22H2,1-8H3/t23?,24-,25+,26+,27?,28+/m0/s1 |
| InChIKey | KOWLZWVNWAAPRV-JQEDHWCDSA-N |
| XLogP | 7.26 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.92 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|