C32H62O5Si2 — CID 67594900
[(3R,4R,5R)-5-[(E)-3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-(2-triethylsilyloxyethyl)oxolan-3-yl]oxy-triethylsilane (PubChem CID 67594900) has the molecular formula C32H62O5Si2 and a molecular weight of 583.02 g/mol. Its IUPAC name is [(3R,4R,5R)-5-[(E)-3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-(2-triethylsilyloxyethyl)oxolan-3-yl]oxy-triethylsilane.
| Compound Name | [(3R,4R,5R)-5-[(E)-3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-(2-triethylsilyloxyethyl)oxolan-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 67594900 |
| Molecular Formula | C32H62O5Si2 |
| Molecular Weight | 583.02 g/mol |
| Exact Mass | 582.41 |
| IUPAC Name | [(3R,4R,5R)-5-[(E)-3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-(2-triethylsilyloxyethyl)oxolan-3-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCC[C@H]1[C@@H](O[Si](CC)(CC)CC)CO[C@@H]1/C=C/C(OC1CCCCO1)C1CCCCC1 |
| InChI | InChI=1S/C32H62O5Si2/c1-7-38(8-2,9-3)35-25-23-28-30(34-26-31(28)37-39(10-4,11-5)12-6)22-21-29(27-18-14-13-15-19-27)36-32-20-16-17-24-33-32/h21-22,27-32H,7-20,23-26H2,1-6H3/b22-21+/t28-,29?,30-,31+,32?/m1/s1 |
| InChIKey | PRUVVMWWCACUKF-OGPUGLNHSA-N |
| XLogP | 8.85 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.02 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|