C26H46O5Si — CID 18718288
2-[(2R,3R,4R)-2-[3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-triethylsilyloxyoxolan-3-yl]acetaldehyde (PubChem CID 18718288) has the molecular formula C26H46O5Si and a molecular weight of 466.74 g/mol. Its IUPAC name is 2-[(2R,3R,4R)-2-[3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-triethylsilyloxyoxolan-3-yl]acetaldehyde.
| Compound Name | 2-[(2R,3R,4R)-2-[3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-triethylsilyloxyoxolan-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 18718288 |
| Molecular Formula | C26H46O5Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 2-[(2R,3R,4R)-2-[3-cyclohexyl-3-(oxan-2-yloxy)prop-1-enyl]-4-triethylsilyloxyoxolan-3-yl]acetaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@H]1CO[C@H](C=CC(OC2CCCCO2)C2CCCCC2)[C@H]1CC=O |
| InChI | InChI=1S/C26H46O5Si/c1-4-32(5-2,6-3)31-25-20-29-24(22(25)17-18-27)16-15-23(21-12-8-7-9-13-21)30-26-14-10-11-19-28-26/h15-16,18,21-26H,4-14,17,19-20H2,1-3H3/t22-,23?,24-,25+,26?/m1/s1 |
| InChIKey | OZONBMLYHGABTO-BJDPOGLMSA-N |
| XLogP | 6.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|