C22H42O5Si — CID 134866147
ethyl (E,4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoate (PubChem CID 134866147) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is ethyl (E,4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoate.
| Compound Name | ethyl (E,4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoate |
|---|---|
| PubChem CID | 134866147 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | ethyl (E,4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@H](OC1CCCCO1)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O5Si/c1-9-24-19(23)14-13-17(2)21(27-20-12-10-11-15-25-20)18(3)16-26-28(7,8)22(4,5)6/h13-14,17-18,20-21H,9-12,15-16H2,1-8H3/b14-13+/t17-,18-,20?,21-/m0/s1 |
| InChIKey | ODORISLCCOQYSV-SBNGIERNSA-N |
| XLogP | 5.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|