C31H58O9Si — CID 56946986
ethyl (Z)-4-[(2S,4S,6S)-6-[(E,4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-4,8-bis(methoxymethoxy)non-1-enyl]-2-methyl-1,3-dioxan-4-yl]-3-methylbut-2-enoate (PubChem CID 56946986) has the molecular formula C31H58O9Si and a molecular weight of 602.88 g/mol. Its IUPAC name is ethyl (Z)-4-[(2S,4S,6S)-6-[(E,4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-4,8-bis(methoxymethoxy)non-1-enyl]-2-methyl-1,3-dioxan-4-yl]-3-methylbut-2-enoate.
| Compound Name | ethyl (Z)-4-[(2S,4S,6S)-6-[(E,4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-4,8-bis(methoxymethoxy)non-1-enyl]-2-methyl-1,3-dioxan-4-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 56946986 |
| Molecular Formula | C31H58O9Si |
| Molecular Weight | 602.88 g/mol |
| Exact Mass | 602.39 |
| IUPAC Name | ethyl (Z)-4-[(2S,4S,6S)-6-[(E,4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-4,8-bis(methoxymethoxy)non-1-enyl]-2-methyl-1,3-dioxan-4-yl]-3-methylbut-2-enoate |
| SMILES | CCOC(=O)/C=C(/C)C[C@H]1C[C@@H](/C=C/C[C@@H](C[C@H](C[C@@H](C)OCOC)O[Si](C)(C)C(C)(C)C)OCOC)O[C@@H](C)O1 |
| InChI | InChI=1S/C31H58O9Si/c1-12-35-30(32)17-23(2)16-28-20-27(38-25(4)39-28)15-13-14-26(37-22-34-9)19-29(18-24(3)36-21-33-8)40-41(10,11)31(5,6)7/h13,15,17,24-29H,12,14,16,18-22H2,1-11H3/b15-13+,23-17-/t24-,25-,26+,27-,28+,29+/m1/s1 |
| InChIKey | OJTFIUZFYQZWEX-UZEBIVQQSA-N |
| XLogP | 6.52 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.88 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|