C24H42O10Si — CID 134832550
ethyl (E)-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-5-triethoxysilylpent-2-enoate (PubChem CID 134832550) has the molecular formula C24H42O10Si and a molecular weight of 518.68 g/mol. Its IUPAC name is ethyl (E)-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-5-triethoxysilylpent-2-enoate.
| Compound Name | ethyl (E)-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-5-triethoxysilylpent-2-enoate |
|---|---|
| PubChem CID | 134832550 |
| Molecular Formula | C24H42O10Si |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | ethyl (E)-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-5-triethoxysilylpent-2-enoate |
| SMILES | CCOC(=O)/C=C(\CC[Si](OCC)(OCC)OCC)C1OC2OC(C)(C)OC2C2OC(C)(C)OC12 |
| InChI | InChI=1S/C24H42O10Si/c1-9-26-17(25)15-16(13-14-35(27-10-2,28-11-3)29-12-4)18-19-20(32-23(5,6)31-19)21-22(30-18)34-24(7,8)33-21/h15,18-22H,9-14H2,1-8H3/b16-15+ |
| InChIKey | CKSRRHSZDXDSBZ-FOCLMDBBSA-N |
| XLogP | 3.31 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|