C19H32O7Si — CID 135012467
(2S)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2H-furan-5-one (PubChem CID 135012467) has the molecular formula C19H32O7Si and a molecular weight of 400.54 g/mol. Its IUPAC name is (2S)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2H-furan-5-one.
| Compound Name | (2S)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 135012467 |
| Molecular Formula | C19H32O7Si |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (2S)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2H-furan-5-one |
| SMILES | CO[C@H]1O[C@H]([C@H]2OC(=O)C=C2CO[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C19H32O7Si/c1-18(2,3)27(7,8)22-10-11-9-12(20)23-13(11)14-15-16(17(21-6)24-14)26-19(4,5)25-15/h9,13-17H,10H2,1-8H3/t13-,14+,15-,16-,17-/m0/s1 |
| InChIKey | WCOPYVNQXFWYBD-QEOTZNIISA-N |
| XLogP | 2.75 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|