C18H28O7Si — CID 135012031
(1S,2R,6R,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,5'-furan]-2'-one (PubChem CID 135012031) has the molecular formula C18H28O7Si and a molecular weight of 384.50 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,5'-furan]-2'-one.
| Compound Name | (1S,2R,6R,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,5'-furan]-2'-one |
|---|---|
| PubChem CID | 135012031 |
| Molecular Formula | C18H28O7Si |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (1S,2R,6R,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,5'-furan]-2'-one |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OC4(C=CC(=O)O4)[C@@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C18H28O7Si/c1-16(2,3)26(6,7)25-14-12-11(23-18(14)9-8-10(19)21-18)13-15(20-12)24-17(4,5)22-13/h8-9,11-15H,1-7H3/t11-,12-,13+,14+,15+,18?/m0/s1 |
| InChIKey | SZZZUNGHBSPMKB-BQPSQBCHSA-N |
| XLogP | 2.46 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|