C23H44O6Si2 — CID 71733142
methyl (Z)-3-[(2R,3S,3aS,5R,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-triethylsilyloxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-yl]prop-2-enoate (PubChem CID 71733142) has the molecular formula C23H44O6Si2 and a molecular weight of 472.77 g/mol. Its IUPAC name is methyl (Z)-3-[(2R,3S,3aS,5R,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-triethylsilyloxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-yl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[(2R,3S,3aS,5R,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-triethylsilyloxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 71733142 |
| Molecular Formula | C23H44O6Si2 |
| Molecular Weight | 472.77 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | methyl (Z)-3-[(2R,3S,3aS,5R,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-triethylsilyloxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-yl]prop-2-enoate |
| SMILES | CC[Si](CC)(CC)O[C@@]1(/C=C\C(=O)OC)C[C@H]2O[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C23H44O6Si2/c1-11-31(12-2,13-3)29-23(15-14-19(24)25-8)16-18-21(27-23)20(17(4)26-18)28-30(9,10)22(5,6)7/h14-15,17-18,20-21H,11-13,16H2,1-10H3/b15-14-/t17-,18-,20+,21+,23+/m1/s1 |
| InChIKey | BIXIFQWILSVFGV-CLEFFPSRSA-N |
| XLogP | 5.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|