C25H46O10Si — CID 10792420
ethyl (E)-3-[(4S,5S)-5-[(2S,3R,4S,5R)-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-3-triethylsilyloxyoxolan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 10792420) has the molecular formula C25H46O10Si and a molecular weight of 534.72 g/mol. Its IUPAC name is ethyl (E)-3-[(4S,5S)-5-[(2S,3R,4S,5R)-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-3-triethylsilyloxyoxolan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4S,5S)-5-[(2S,3R,4S,5R)-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-3-triethylsilyloxyoxolan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10792420 |
| Molecular Formula | C25H46O10Si |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | ethyl (E)-3-[(4S,5S)-5-[(2S,3R,4S,5R)-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-3-triethylsilyloxyoxolan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1OC(C)(C)O[C@@H]1[C@@H]1O[C@H](COCOC)[C@H](OCOC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H46O10Si/c1-9-30-20(26)14-13-18-22(34-25(5,6)33-18)23-24(35-36(10-2,11-3)12-4)21(31-17-28-8)19(32-23)15-29-16-27-7/h13-14,18-19,21-24H,9-12,15-17H2,1-8H3/b14-13+/t18-,19+,21-,22-,23-,24-/m0/s1 |
| InChIKey | LRXDMCVFSNXOAY-WHUNEMAJSA-N |
| XLogP | 3.39 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|