C38H70O9Si — CID 11158287
ethyl (2E,4R,6S,7S,8E,12R)-7-acetyloxy-6-(methoxymethoxy)-2,4-dimethyl-12-[2-[(3S)-3-methyl-4-tri(propan-2-yl)silyloxybutyl]-1,3-dioxolan-2-yl]trideca-2,8-dienoate (PubChem CID 11158287) has the molecular formula C38H70O9Si and a molecular weight of 699.06 g/mol. Its IUPAC name is ethyl (2E,4R,6S,7S,8E,12R)-7-acetyloxy-6-(methoxymethoxy)-2,4-dimethyl-12-[2-[(3S)-3-methyl-4-tri(propan-2-yl)silyloxybutyl]-1,3-dioxolan-2-yl]trideca-2,8-dienoate.
| Compound Name | ethyl (2E,4R,6S,7S,8E,12R)-7-acetyloxy-6-(methoxymethoxy)-2,4-dimethyl-12-[2-[(3S)-3-methyl-4-tri(propan-2-yl)silyloxybutyl]-1,3-dioxolan-2-yl]trideca-2,8-dienoate |
|---|---|
| PubChem CID | 11158287 |
| Molecular Formula | C38H70O9Si |
| Molecular Weight | 699.06 g/mol |
| Exact Mass | 698.48 |
| IUPAC Name | ethyl (2E,4R,6S,7S,8E,12R)-7-acetyloxy-6-(methoxymethoxy)-2,4-dimethyl-12-[2-[(3S)-3-methyl-4-tri(propan-2-yl)silyloxybutyl]-1,3-dioxolan-2-yl]trideca-2,8-dienoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C)C[C@H](OCOC)[C@H](/C=C/CC[C@@H](C)C1(CC[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)OCCO1)OC(C)=O |
| InChI | InChI=1S/C38H70O9Si/c1-14-42-37(40)32(10)23-31(9)24-36(43-26-41-13)35(47-34(12)39)18-16-15-17-33(11)38(44-21-22-45-38)20-19-30(8)25-46-48(27(2)3,28(4)5)29(6)7/h16,18,23,27-31,33,35-36H,14-15,17,19-22,24-26H2,1-13H3/b18-16+,32-23+/t30-,31-,33+,35-,36-/m0/s1 |
| InChIKey | DZUSABAWVJNXCV-RDDMHPIGSA-N |
| XLogP | 8.77 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.06 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|