C21H40O5Si — CID 102202167
ethyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]pent-2-enoate (PubChem CID 102202167) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is ethyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]pent-2-enoate.
| Compound Name | ethyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]pent-2-enoate |
|---|---|
| PubChem CID | 102202167 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | ethyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@@H](C)COC(C)(C)O1 |
| InChI | InChI=1S/C21H40O5Si/c1-10-23-19(22)13-11-12-17(26-27(8,9)20(3,4)5)18-14-16(2)15-24-21(6,7)25-18/h11,13,16-18H,10,12,14-15H2,1-9H3/b13-11+/t16-,17+,18+/m1/s1 |
| InChIKey | ONTDVCXCMVALIX-CJWUOFAOSA-N |
| XLogP | 5.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|