C35H58O6Si — CID 140520607
(3E,9E)-13-[but-3-en-2-yl-di(propan-2-yl)silyl]oxy-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-15-methyl-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one (PubChem CID 140520607) has the molecular formula C35H58O6Si and a molecular weight of 602.93 g/mol. Its IUPAC name is (3E,9E)-13-[but-3-en-2-yl-di(propan-2-yl)silyl]oxy-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-15-methyl-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one.
| Compound Name | (3E,9E)-13-[but-3-en-2-yl-di(propan-2-yl)silyl]oxy-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-15-methyl-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
|---|---|
| PubChem CID | 140520607 |
| Molecular Formula | C35H58O6Si |
| Molecular Weight | 602.93 g/mol |
| Exact Mass | 602.40 |
| IUPAC Name | (3E,9E)-13-[but-3-en-2-yl-di(propan-2-yl)silyl]oxy-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-15-methyl-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
| SMILES | C=CC(C)[Si](OC1CC/C=C/CC(C2COC(C)(C)O2)OC(=O)/C=C/CC2C=CCC(CC(C)C1)O2)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H58O6Si/c1-10-28(7)42(25(2)3,26(4)5)41-31-16-12-11-13-20-32(33-24-37-35(8,9)40-33)39-34(36)21-15-18-29-17-14-19-30(38-29)22-27(6)23-31/h10-11,13-15,17,21,25-33H,1,12,16,18-20,22-24H2,2-9H3/b13-11+,21-15+ |
| InChIKey | RGXOMLWKCJERTG-DTXJCZLISA-N |
| XLogP | 8.59 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.93 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|