C24H40O5Si — CID 91538996
(1R,5S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-5,10,16,16-tetramethyl-6,15,17-trioxabicyclo[12.3.0]heptadec-2-en-8-yn-7-one (PubChem CID 91538996) has the molecular formula C24H40O5Si and a molecular weight of 436.67 g/mol. Its IUPAC name is (1R,5S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-5,10,16,16-tetramethyl-6,15,17-trioxabicyclo[12.3.0]heptadec-2-en-8-yn-7-one.
| Compound Name | (1R,5S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-5,10,16,16-tetramethyl-6,15,17-trioxabicyclo[12.3.0]heptadec-2-en-8-yn-7-one |
|---|---|
| PubChem CID | 91538996 |
| Molecular Formula | C24H40O5Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (1R,5S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-5,10,16,16-tetramethyl-6,15,17-trioxabicyclo[12.3.0]heptadec-2-en-8-yn-7-one |
| SMILES | CC1C#CC(=O)O[C@@H](C)CC=C[C@H]2OC(C)(C)O[C@H]2CCC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H40O5Si/c1-17-13-16-22(25)26-18(2)11-10-12-20-21(28-24(6,7)27-20)15-14-19(17)29-30(8,9)23(3,4)5/h10,12,17-21H,11,14-15H2,1-9H3/t17?,18-,19?,20+,21-/m0/s1 |
| InChIKey | NEZHRKKHMLGLGD-QAZZVPAXSA-N |
| XLogP | 5.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|