C33H52O6Si — CID 15984616
(1S,4E,6R,10R,11E,13E,15S,18R,19R,20S)-8,8,15-trimethyl-18-[(2R)-pent-4-yn-2-yl]-19-triethylsilyloxy-7,9,17,23-tetraoxatricyclo[18.2.1.06,10]tricosa-4,11,13-trien-16-one (PubChem CID 15984616) has the molecular formula C33H52O6Si and a molecular weight of 572.86 g/mol. Its IUPAC name is (1S,4E,6R,10R,11E,13E,15S,18R,19R,20S)-8,8,15-trimethyl-18-[(2R)-pent-4-yn-2-yl]-19-triethylsilyloxy-7,9,17,23-tetraoxatricyclo[18.2.1.06,10]tricosa-4,11,13-trien-16-one.
| Compound Name | (1S,4E,6R,10R,11E,13E,15S,18R,19R,20S)-8,8,15-trimethyl-18-[(2R)-pent-4-yn-2-yl]-19-triethylsilyloxy-7,9,17,23-tetraoxatricyclo[18.2.1.06,10]tricosa-4,11,13-trien-16-one |
|---|---|
| PubChem CID | 15984616 |
| Molecular Formula | C33H52O6Si |
| Molecular Weight | 572.86 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | (1S,4E,6R,10R,11E,13E,15S,18R,19R,20S)-8,8,15-trimethyl-18-[(2R)-pent-4-yn-2-yl]-19-triethylsilyloxy-7,9,17,23-tetraoxatricyclo[18.2.1.06,10]tricosa-4,11,13-trien-16-one |
| SMILES | C#CC[C@@H](C)[C@H]1OC(=O)[C@@H](C)/C=C/C=C/[C@H]2OC(C)(C)O[C@@H]2/C=C/CC[C@H]2CC[C@H](O2)[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H52O6Si/c1-9-17-24(5)30-31(39-40(10-2,11-3)12-4)29-23-22-26(35-29)19-14-16-21-28-27(37-33(7,8)38-28)20-15-13-18-25(6)32(34)36-30/h1,13,15-16,18,20-21,24-31H,10-12,14,17,19,22-23H2,2-8H3/b18-13+,20-15+,21-16+/t24-,25+,26+,27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | ZDCGZUAACZHIHQ-BQXONRLDSA-N |
| XLogP | 7.11 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.86 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|