C24H44O4Si — CID 123711033
[(4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethyloct-7-enyl] hepta-2,6-dienoate (PubChem CID 123711033) has the molecular formula C24H44O4Si and a molecular weight of 424.70 g/mol. Its IUPAC name is [(4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethyloct-7-enyl] hepta-2,6-dienoate.
| Compound Name | [(4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethyloct-7-enyl] hepta-2,6-dienoate |
|---|---|
| PubChem CID | 123711033 |
| Molecular Formula | C24H44O4Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | [(4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethyloct-7-enyl] hepta-2,6-dienoate |
| SMILES | C=CCCC=CC(=O)OCC(C)C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=C)OC |
| InChI | InChI=1S/C24H44O4Si/c1-11-13-14-15-16-22(25)27-18-19(3)17-20(4)23(21(12-2)26-8)28-29(9,10)24(5,6)7/h11-12,15-16,19-21,23H,1-2,13-14,17-18H2,3-10H3/t19?,20-,21+,23+/m1/s1 |
| InChIKey | YLURWCIQZPPHBK-VEPKZSNGSA-N |
| XLogP | 6.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|