C24H50O4Si2 — CID 134866150
methyl (E,4S,5S,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylnon-2-enoate (PubChem CID 134866150) has the molecular formula C24H50O4Si2 and a molecular weight of 458.83 g/mol. Its IUPAC name is methyl (E,4S,5S,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylnon-2-enoate.
| Compound Name | methyl (E,4S,5S,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylnon-2-enoate |
|---|---|
| PubChem CID | 134866150 |
| Molecular Formula | C24H50O4Si2 |
| Molecular Weight | 458.83 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | methyl (E,4S,5S,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylnon-2-enoate |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/C(=O)OC |
| InChI | InChI=1S/C24H50O4Si2/c1-15-20(27-29(11,12)23(4,5)6)19(3)22(18(2)16-17-21(25)26-10)28-30(13,14)24(7,8)9/h16-20,22H,15H2,1-14H3/b17-16+/t18-,19-,20+,22-/m0/s1 |
| InChIKey | QZSGSVXLLMGQPZ-XESBZFCCSA-N |
| XLogP | 7.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.83 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|