C17H26O7 — CID 10315329
ethyl (E)-4-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]but-2-enoate (PubChem CID 10315329) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is ethyl (E)-4-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]but-2-enoate.
| Compound Name | ethyl (E)-4-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]but-2-enoate |
|---|---|
| PubChem CID | 10315329 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | ethyl (E)-4-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H26O7/c1-6-19-11(18)9-7-8-10-12-13(22-16(2,3)21-12)14-15(20-10)24-17(4,5)23-14/h7,9-10,12-15H,6,8H2,1-5H3/b9-7+/t10-,12+,13+,14-,15-/m1/s1 |
| InChIKey | ZVXZTWAYKLYYOP-IDIKPLMWSA-N |
| XLogP | 1.89 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|