C19H24O12 — CID 134844551
[3,4,5-triacetyloxy-6-[[(2S)-5-oxo-2H-furan-2-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 134844551) has the molecular formula C19H24O12 and a molecular weight of 444.39 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[[(2S)-5-oxo-2H-furan-2-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[[(2S)-5-oxo-2H-furan-2-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134844551 |
| Molecular Formula | C19H24O12 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[[(2S)-5-oxo-2H-furan-2-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC[C@@H]2C=CC(=O)O2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H24O12/c1-9(20)25-8-14-16(27-10(2)21)17(28-11(3)22)18(29-12(4)23)19(31-14)26-7-13-5-6-15(24)30-13/h5-6,13-14,16-19H,7-8H2,1-4H3/t13-,14?,16?,17?,18?,19?/m0/s1 |
| InChIKey | RKKFEBLBGMUVGU-CDZFTEIVSA-N |
| XLogP | -0.43 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|