C18H28O7 — CID 134944873
propan-2-yl (E)-2-methyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-enoate (PubChem CID 134944873) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is propan-2-yl (E)-2-methyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-enoate.
| Compound Name | propan-2-yl (E)-2-methyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134944873 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | propan-2-yl (E)-2-methyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-enoate |
| SMILES | C/C(=C\[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21)C(=O)OC(C)C |
| InChI | InChI=1S/C18H28O7/c1-9(2)20-15(19)10(3)8-11-12-13(23-17(4,5)22-12)14-16(21-11)25-18(6,7)24-14/h8-9,11-14,16H,1-7H3/b10-8+/t11-,12+,13+,14-,16-/m1/s1 |
| InChIKey | VZIQMDGQMQQWQW-YLXOGMMVSA-N |
| XLogP | 2.28 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|