C15H22O6 — CID 134941644
(2S,3aR,6'S,7aR)-4'-hydroxy-6'-[(2R)-2-hydroxybutyl]spiro[3a,7a-dihydro-3H-furo[3,2-b]pyran-2,2'-oxane]-5-one (PubChem CID 134941644) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2S,3aR,6'S,7aR)-4'-hydroxy-6'-[(2R)-2-hydroxybutyl]spiro[3a,7a-dihydro-3H-furo[3,2-b]pyran-2,2'-oxane]-5-one.
| Compound Name | (2S,3aR,6'S,7aR)-4'-hydroxy-6'-[(2R)-2-hydroxybutyl]spiro[3a,7a-dihydro-3H-furo[3,2-b]pyran-2,2'-oxane]-5-one |
|---|---|
| PubChem CID | 134941644 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2S,3aR,6'S,7aR)-4'-hydroxy-6'-[(2R)-2-hydroxybutyl]spiro[3a,7a-dihydro-3H-furo[3,2-b]pyran-2,2'-oxane]-5-one |
| SMILES | CC[C@@H](O)C[C@H]1CC(O)C[C@]2(C[C@H]3OC(=O)C=C[C@H]3O2)O1 |
| InChI | InChI=1S/C15H22O6/c1-2-9(16)5-11-6-10(17)7-15(20-11)8-13-12(21-15)3-4-14(18)19-13/h3-4,9-13,16-17H,2,5-8H2,1H3/t9-,10?,11+,12-,13-,15+/m1/s1 |
| InChIKey | TZAKDTHYSWRCNI-XHTDKKDTSA-N |
| XLogP | 0.65 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |