C31H58O5Si — CID 163319753
[(E,4R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,6R)-6-[(Z)-hex-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-6-methyldec-6-en-4-yl] acetate (PubChem CID 163319753) has the molecular formula C31H58O5Si and a molecular weight of 538.89 g/mol. Its IUPAC name is [(E,4R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,6R)-6-[(Z)-hex-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-6-methyldec-6-en-4-yl] acetate.
| Compound Name | [(E,4R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,6R)-6-[(Z)-hex-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-6-methyldec-6-en-4-yl] acetate |
|---|---|
| PubChem CID | 163319753 |
| Molecular Formula | C31H58O5Si |
| Molecular Weight | 538.89 g/mol |
| Exact Mass | 538.41 |
| IUPAC Name | [(E,4R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,6R)-6-[(Z)-hex-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-6-methyldec-6-en-4-yl] acetate |
| SMILES | C/C=C\CCC[C@@H]1C[C@@H]([C@H](C)[C@@H](/C=C(\C)C[C@@H](CCC)OC(C)=O)O[Si](C)(C)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C31H58O5Si/c1-13-15-16-17-19-27-22-28(35-31(9,10)34-27)24(4)29(36-37(11,12)30(6,7)8)21-23(3)20-26(18-14-2)33-25(5)32/h13,15,21,24,26-29H,14,16-20,22H2,1-12H3/b15-13-,23-21+/t24-,26+,27+,28-,29+/m0/s1 |
| InChIKey | NXZBGMHQGFQVAP-AKPSOGDFSA-N |
| XLogP | 8.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.89 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|