C25H44O5 — CID 163319752
[(E,4R,8R,9R)-9-[(4S,6R)-6-[(Z)-hex-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-8-hydroxy-6-methyldec-6-en-4-yl] acetate (PubChem CID 163319752) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is [(E,4R,8R,9R)-9-[(4S,6R)-6-[(Z)-hex-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-8-hydroxy-6-methyldec-6-en-4-yl] acetate.
| Compound Name | [(E,4R,8R,9R)-9-[(4S,6R)-6-[(Z)-hex-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-8-hydroxy-6-methyldec-6-en-4-yl] acetate |
|---|---|
| PubChem CID | 163319752 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | [(E,4R,8R,9R)-9-[(4S,6R)-6-[(Z)-hex-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-8-hydroxy-6-methyldec-6-en-4-yl] acetate |
| SMILES | C/C=C\CCC[C@@H]1C[C@@H]([C@H](C)[C@H](O)/C=C(\C)C[C@@H](CCC)OC(C)=O)OC(C)(C)O1 |
| InChI | InChI=1S/C25H44O5/c1-8-10-11-12-14-22-17-24(30-25(6,7)29-22)19(4)23(27)16-18(3)15-21(13-9-2)28-20(5)26/h8,10,16,19,21-24,27H,9,11-15,17H2,1-7H3/b10-8-,18-16+/t19-,21-,22-,23-,24+/m1/s1 |
| InChIKey | ICIOZYWQKFYFIG-XJRMQWLGSA-N |
| XLogP | 5.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|