C24H44O3Si — CID 135070779
bis[(Z)-but-2-enyl]-[(2R,3S)-3-methyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]pent-4-en-2-yl]oxysilane (PubChem CID 135070779) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is bis[(Z)-but-2-enyl]-[(2R,3S)-3-methyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]pent-4-en-2-yl]oxysilane.
| Compound Name | bis[(Z)-but-2-enyl]-[(2R,3S)-3-methyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]pent-4-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 135070779 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | bis[(Z)-but-2-enyl]-[(2R,3S)-3-methyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]pent-4-en-2-yl]oxysilane |
| SMILES | C=C[C@H](C)[C@@H](C[C@@H]1OC(C)(C)O[C@H](C(C)C)[C@H]1C)O[SiH](C/C=C\C)C/C=C\C |
| InChI | InChI=1S/C24H44O3Si/c1-10-13-15-28(16-14-11-2)27-21(19(6)12-3)17-22-20(7)23(18(4)5)26-24(8,9)25-22/h10-14,18-23,28H,3,15-17H2,1-2,4-9H3/b13-10-,14-11-/t19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | LULGNSYFPPHDOB-XHEUYWEDSA-N |
| XLogP | 6.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|