C22H36O5Si — CID 154706950
[3-[4-[tert-butyl(dimethyl)silyl]oxy-4-(cyclopenten-1-yl)butyl]-5-oxo-2H-pyran-2-yl] acetate (PubChem CID 154706950) has the molecular formula C22H36O5Si and a molecular weight of 408.61 g/mol. Its IUPAC name is [3-[4-[tert-butyl(dimethyl)silyl]oxy-4-(cyclopenten-1-yl)butyl]-5-oxo-2H-pyran-2-yl] acetate.
| Compound Name | [3-[4-[tert-butyl(dimethyl)silyl]oxy-4-(cyclopenten-1-yl)butyl]-5-oxo-2H-pyran-2-yl] acetate |
|---|---|
| PubChem CID | 154706950 |
| Molecular Formula | C22H36O5Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | [3-[4-[tert-butyl(dimethyl)silyl]oxy-4-(cyclopenten-1-yl)butyl]-5-oxo-2H-pyran-2-yl] acetate |
| SMILES | CC(=O)OC1OCC(=O)C=C1CCCC(O[Si](C)(C)C(C)(C)C)C1=CCCC1 |
| InChI | InChI=1S/C22H36O5Si/c1-16(23)26-21-18(14-19(24)15-25-21)12-9-13-20(17-10-7-8-11-17)27-28(5,6)22(2,3)4/h10,14,20-21H,7-9,11-13,15H2,1-6H3 |
| InChIKey | OHCULPBTGIRXFX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|