C21H38O5Si — CID 15723412
1-(5-oxo-2-triethylsilyloxy-2H-furan-3-yl)nonyl acetate (PubChem CID 15723412) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is 1-(5-oxo-2-triethylsilyloxy-2H-furan-3-yl)nonyl acetate.
| Compound Name | 1-(5-oxo-2-triethylsilyloxy-2H-furan-3-yl)nonyl acetate |
|---|---|
| PubChem CID | 15723412 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 1-(5-oxo-2-triethylsilyloxy-2H-furan-3-yl)nonyl acetate |
| SMILES | CCCCCCCCC(OC(C)=O)C1=CC(=O)OC1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H38O5Si/c1-6-10-11-12-13-14-15-19(24-17(5)22)18-16-20(23)25-21(18)26-27(7-2,8-3)9-4/h16,19,21H,6-15H2,1-5H3 |
| InChIKey | PTMBVBOFAPJRCQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|