C27H48O5Si — CID 14081619
ethyl (2E,4E,6E,8S,9R,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-8,10-dimethyl-11-(oxan-2-yloxy)dodeca-2,4,6-trienoate (PubChem CID 14081619) has the molecular formula C27H48O5Si and a molecular weight of 480.76 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8S,9R,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-8,10-dimethyl-11-(oxan-2-yloxy)dodeca-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E,8S,9R,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-8,10-dimethyl-11-(oxan-2-yloxy)dodeca-2,4,6-trienoate |
|---|---|
| PubChem CID | 14081619 |
| Molecular Formula | C27H48O5Si |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | ethyl (2E,4E,6E,8S,9R,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-8,10-dimethyl-11-(oxan-2-yloxy)dodeca-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C/C=C/C=C/[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C27H48O5Si/c1-10-29-24(28)18-14-12-11-13-17-21(2)26(32-33(8,9)27(5,6)7)22(3)23(4)31-25-19-15-16-20-30-25/h11-14,17-18,21-23,25-26H,10,15-16,19-20H2,1-9H3/b12-11+,17-13+,18-14+/t21-,22-,23-,25?,26+/m0/s1 |
| InChIKey | LQBDUCQVYSJHQA-DDLMIJLFSA-N |
| XLogP | 6.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|