C21H38O5Si — CID 134982850
ethyl (2E,4E,6S,7S,8S)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethylnona-2,4-dienoate (PubChem CID 134982850) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is ethyl (2E,4E,6S,7S,8S)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethylnona-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6S,7S,8S)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethylnona-2,4-dienoate |
|---|---|
| PubChem CID | 134982850 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | ethyl (2E,4E,6S,7S,8S)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethylnona-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/[C@H](C)[C@H](OC(C)=O)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O5Si/c1-10-24-19(23)14-12-11-13-16(2)20(26-18(4)22)17(3)15-25-27(8,9)21(5,6)7/h11-14,16-17,20H,10,15H2,1-9H3/b13-11+,14-12+/t16-,17-,20-/m0/s1 |
| InChIKey | MYGSEEFLHOBUGO-XIKBFADJSA-N |
| XLogP | 4.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|