C20H38O5Si — CID 5364267
methyl (2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-6,8-dimethylnona-2,4-dienoate (PubChem CID 5364267) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is methyl (2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-6,8-dimethylnona-2,4-dienoate.
| Compound Name | methyl (2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-6,8-dimethylnona-2,4-dienoate |
|---|---|
| PubChem CID | 5364267 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | methyl (2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-6,8-dimethylnona-2,4-dienoate |
| SMILES | COCOCC(C)C(O[Si](C)(C)C(C)(C)C)C(C)/C=C/C=C/C(=O)OC |
| InChI | InChI=1S/C20H38O5Si/c1-16(12-10-11-13-18(21)23-7)19(17(2)14-24-15-22-6)25-26(8,9)20(3,4)5/h10-13,16-17,19H,14-15H2,1-9H3/b12-10+,13-11+ |
| InChIKey | JMPNGUACKBQAPH-DCIPZJNNSA-N |
| XLogP | 4.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|