C28H49BrO5Si — CID 10650774
ethyl (2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenoate (PubChem CID 10650774) has the molecular formula C28H49BrO5Si and a molecular weight of 573.69 g/mol. Its IUPAC name is ethyl (2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenoate.
| Compound Name | ethyl (2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenoate |
|---|---|
| PubChem CID | 10650774 |
| Molecular Formula | C28H49BrO5Si |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | ethyl (2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](C)C[C@H](C)[C@@H](/C=C(Br)/C=C/C(C)=C/CO[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C28H49BrO5Si/c1-12-32-27(30)24(5)18-22(3)17-23(4)26(33-20-31-9)19-25(29)14-13-21(2)15-16-34-35(10,11)28(6,7)8/h13-15,18-19,22-23,26H,12,16-17,20H2,1-11H3/b14-13+,21-15+,24-18+,25-19-/t22-,23-,26+/m0/s1 |
| InChIKey | OJGRLAKLUZCYNJ-QPBPNPEDSA-N |
| XLogP | 7.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|