C21H42O5Si — CID 11463793
ethyl (E,4R,5S,6S)-8-(methoxymethoxy)-2,4,6-trimethyl-5-triethylsilyloxyoct-2-enoate (PubChem CID 11463793) has the molecular formula C21H42O5Si and a molecular weight of 402.65 g/mol. Its IUPAC name is ethyl (E,4R,5S,6S)-8-(methoxymethoxy)-2,4,6-trimethyl-5-triethylsilyloxyoct-2-enoate.
| Compound Name | ethyl (E,4R,5S,6S)-8-(methoxymethoxy)-2,4,6-trimethyl-5-triethylsilyloxyoct-2-enoate |
|---|---|
| PubChem CID | 11463793 |
| Molecular Formula | C21H42O5Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | ethyl (E,4R,5S,6S)-8-(methoxymethoxy)-2,4,6-trimethyl-5-triethylsilyloxyoct-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)CCOCOC |
| InChI | InChI=1S/C21H42O5Si/c1-9-25-21(22)19(7)15-18(6)20(17(5)13-14-24-16-23-8)26-27(10-2,11-3)12-4/h15,17-18,20H,9-14,16H2,1-8H3/b19-15+/t17-,18+,20-/m0/s1 |
| InChIKey | RNRGUENGGJBINZ-FRRGBFTHSA-N |
| XLogP | 5.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|