C28H49IO5Si — CID 134941097
[(1E,4R,5R,6E)-8-[tert-butyl(dimethyl)silyl]oxy-1-iodo-2,5,7-trimethylocta-1,6-dien-4-yl] (2E,7S)-7-(methoxymethoxy)nona-2,8-dienoate (PubChem CID 134941097) has the molecular formula C28H49IO5Si and a molecular weight of 620.69 g/mol. Its IUPAC name is [(1E,4R,5R,6E)-8-[tert-butyl(dimethyl)silyl]oxy-1-iodo-2,5,7-trimethylocta-1,6-dien-4-yl] (2E,7S)-7-(methoxymethoxy)nona-2,8-dienoate.
| Compound Name | [(1E,4R,5R,6E)-8-[tert-butyl(dimethyl)silyl]oxy-1-iodo-2,5,7-trimethylocta-1,6-dien-4-yl] (2E,7S)-7-(methoxymethoxy)nona-2,8-dienoate |
|---|---|
| PubChem CID | 134941097 |
| Molecular Formula | C28H49IO5Si |
| Molecular Weight | 620.69 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | [(1E,4R,5R,6E)-8-[tert-butyl(dimethyl)silyl]oxy-1-iodo-2,5,7-trimethylocta-1,6-dien-4-yl] (2E,7S)-7-(methoxymethoxy)nona-2,8-dienoate |
| SMILES | C=C[C@H](CCC/C=C/C(=O)O[C@H](C/C(C)=C/I)[C@H](C)/C=C(\C)CO[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C28H49IO5Si/c1-11-25(32-21-31-8)15-13-12-14-16-27(30)34-26(18-22(2)19-29)24(4)17-23(3)20-33-35(9,10)28(5,6)7/h11,14,16-17,19,24-26H,1,12-13,15,18,20-21H2,2-10H3/b16-14+,22-19+,23-17+/t24-,25-,26-/m1/s1 |
| InChIKey | FLFHUBOMEBSGLJ-QEFHVENNSA-N |
| XLogP | 8.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.69 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|