C23H45IO4Si2 — CID 134887041
2-trimethylsilylethoxymethyl (2E,4S,5R,6E)-7-iodo-4-methyl-5-tri(propan-2-yl)silyloxyhepta-2,6-dienoate (PubChem CID 134887041) has the molecular formula C23H45IO4Si2 and a molecular weight of 568.69 g/mol. Its IUPAC name is 2-trimethylsilylethoxymethyl (2E,4S,5R,6E)-7-iodo-4-methyl-5-tri(propan-2-yl)silyloxyhepta-2,6-dienoate.
| Compound Name | 2-trimethylsilylethoxymethyl (2E,4S,5R,6E)-7-iodo-4-methyl-5-tri(propan-2-yl)silyloxyhepta-2,6-dienoate |
|---|---|
| PubChem CID | 134887041 |
| Molecular Formula | C23H45IO4Si2 |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 2-trimethylsilylethoxymethyl (2E,4S,5R,6E)-7-iodo-4-methyl-5-tri(propan-2-yl)silyloxyhepta-2,6-dienoate |
| SMILES | CC(C)[Si](O[C@@H](/C=C/I)[C@@H](C)/C=C/C(=O)OCOCC[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H45IO4Si2/c1-18(2)30(19(3)4,20(5)6)28-22(13-14-24)21(7)11-12-23(25)27-17-26-15-16-29(8,9)10/h11-14,18-22H,15-17H2,1-10H3/b12-11+,14-13+/t21-,22-/m0/s1 |
| InChIKey | NFOGQDFWXUFNBI-UGUBCGCLSA-N |
| XLogP | 7.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|