C19H37IO5Si — CID 10896373
methyl (Z,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(1-ethoxy-2-iodoethoxy)-6-methylhept-2-enoate (PubChem CID 10896373) has the molecular formula C19H37IO5Si and a molecular weight of 500.49 g/mol. Its IUPAC name is methyl (Z,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(1-ethoxy-2-iodoethoxy)-6-methylhept-2-enoate.
| Compound Name | methyl (Z,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(1-ethoxy-2-iodoethoxy)-6-methylhept-2-enoate |
|---|---|
| PubChem CID | 10896373 |
| Molecular Formula | C19H37IO5Si |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | methyl (Z,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(1-ethoxy-2-iodoethoxy)-6-methylhept-2-enoate |
| SMILES | CCOC(CI)O[C@H](C/C=C\C(=O)OC)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H37IO5Si/c1-9-23-18(13-20)25-16(11-10-12-17(21)22-6)15(2)14-24-26(7,8)19(3,4)5/h10,12,15-16,18H,9,11,13-14H2,1-8H3/b12-10-/t15-,16-,18?/m1/s1 |
| InChIKey | RPHJGDWHFYONGQ-NXASGLAASA-N |
| XLogP | 4.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|