C20H42O5Si2 — CID 10645731
ethyl (E,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2-trimethylsilylethoxymethoxy)hex-2-enoate (PubChem CID 10645731) has the molecular formula C20H42O5Si2 and a molecular weight of 418.72 g/mol. Its IUPAC name is ethyl (E,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2-trimethylsilylethoxymethoxy)hex-2-enoate.
| Compound Name | ethyl (E,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2-trimethylsilylethoxymethoxy)hex-2-enoate |
|---|---|
| PubChem CID | 10645731 |
| Molecular Formula | C20H42O5Si2 |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | ethyl (E,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2-trimethylsilylethoxymethoxy)hex-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](CO[Si](C)(C)C(C)(C)C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C20H42O5Si2/c1-10-23-19(21)13-11-12-18(16-25-27(8,9)20(2,3)4)24-17-22-14-15-26(5,6)7/h11,13,18H,10,12,14-17H2,1-9H3/b13-11+/t18-/m0/s1 |
| InChIKey | RPISZTGLAYPZQU-YLZCUGDYSA-N |
| XLogP | 5.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|