C24H46O6Si2 — CID 14737941
[(2Z,4S,5S,6Z)-8-acetyloxy-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienyl] acetate (PubChem CID 14737941) has the molecular formula C24H46O6Si2 and a molecular weight of 486.80 g/mol. Its IUPAC name is [(2Z,4S,5S,6Z)-8-acetyloxy-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienyl] acetate.
| Compound Name | [(2Z,4S,5S,6Z)-8-acetyloxy-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 14737941 |
| Molecular Formula | C24H46O6Si2 |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [(2Z,4S,5S,6Z)-8-acetyloxy-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C\COC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O6Si2/c1-19(25)27-17-13-15-21(29-31(9,10)23(3,4)5)22(16-14-18-28-20(2)26)30-32(11,12)24(6,7)8/h13-16,21-22H,17-18H2,1-12H3/b15-13-,16-14-/t21-,22-/m0/s1 |
| InChIKey | MVKVAGNCWWCQLG-NDEBMARISA-N |
| XLogP | 6.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|