C16H30O4Si — CID 46193207
tert-butyl (Z)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]prop-2-enoate (PubChem CID 46193207) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is tert-butyl (Z)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]prop-2-enoate.
| Compound Name | tert-butyl (Z)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 46193207 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | tert-butyl (Z)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C\[C@@H]1O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O4Si/c1-15(2,3)20-14(17)10-9-12-13(19-12)11-18-21(7,8)16(4,5)6/h9-10,12-13H,11H2,1-8H3/b10-9-/t12-,13-/m0/s1 |
| InChIKey | ZCSMXJBCULORBL-DQKWEHNMSA-N |
| XLogP | 3.67 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|