C14H28O5Si — CID 71567019
methyl (E,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methoxyhex-2-enoate (PubChem CID 71567019) has the molecular formula C14H28O5Si and a molecular weight of 304.46 g/mol. Its IUPAC name is methyl (E,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methoxyhex-2-enoate.
| Compound Name | methyl (E,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methoxyhex-2-enoate |
|---|---|
| PubChem CID | 71567019 |
| Molecular Formula | C14H28O5Si |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | methyl (E,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methoxyhex-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](OC)[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O5Si/c1-14(2,3)20(6,7)19-10-11(15)12(17-4)8-9-13(16)18-5/h8-9,11-12,15H,10H2,1-7H3/b9-8+/t11-,12+/m0/s1 |
| InChIKey | SACNRVWFFYPOIT-VDTGWRSZSA-N |
| XLogP | 2.11 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|