C16H26O5Si — CID 11624020
(2S,3S)-2-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxopent-1-enyl]-3-hydroxy-2,3-dihydropyran-6-one (PubChem CID 11624020) has the molecular formula C16H26O5Si and a molecular weight of 326.47 g/mol. Its IUPAC name is (2S,3S)-2-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxopent-1-enyl]-3-hydroxy-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-2-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxopent-1-enyl]-3-hydroxy-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11624020 |
| Molecular Formula | C16H26O5Si |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (2S,3S)-2-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxopent-1-enyl]-3-hydroxy-2,3-dihydropyran-6-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)/C=C/[C@@H]1OC(=O)C=C[C@@H]1O |
| InChI | InChI=1S/C16H26O5Si/c1-11(21-22(5,6)16(2,3)4)12(17)7-9-14-13(18)8-10-15(19)20-14/h7-11,13-14,18H,1-6H3/b9-7+/t11-,13-,14-/m0/s1 |
| InChIKey | HEEBXFBUHDAUBW-GPXCDHPNSA-N |
| XLogP | 2.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|