C18H30O5Si — CID 11508665
[(3S,4S,5E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxonona-1,5-dien-4-yl] prop-2-enoate (PubChem CID 11508665) has the molecular formula C18H30O5Si and a molecular weight of 354.52 g/mol. Its IUPAC name is [(3S,4S,5E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxonona-1,5-dien-4-yl] prop-2-enoate.
| Compound Name | [(3S,4S,5E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxonona-1,5-dien-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11508665 |
| Molecular Formula | C18H30O5Si |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [(3S,4S,5E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxonona-1,5-dien-4-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H](/C=C/C(=O)[C@H](C)O[Si](C)(C)C(C)(C)C)[C@@H](O)C=C |
| InChI | InChI=1S/C18H30O5Si/c1-9-14(19)16(22-17(21)10-2)12-11-15(20)13(3)23-24(7,8)18(4,5)6/h9-14,16,19H,1-2H2,3-8H3/b12-11+/t13-,14-,16-/m0/s1 |
| InChIKey | PJZKGMBSTLAQKM-VFCLJNIBSA-N |
| XLogP | 3.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|