C13H26O4Si — CID 25171275
methyl (E,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhex-2-enoate (PubChem CID 25171275) has the molecular formula C13H26O4Si and a molecular weight of 274.43 g/mol. Its IUPAC name is methyl (E,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhex-2-enoate.
| Compound Name | methyl (E,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhex-2-enoate |
|---|---|
| PubChem CID | 25171275 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | methyl (E,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhex-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C13H26O4Si/c1-10(14)11(8-9-12(15)16-5)17-18(6,7)13(2,3)4/h8-11,14H,1-7H3/b9-8+/t10-,11+/m1/s1 |
| InChIKey | GTBMSLLLQACEJU-OJLMFNQTSA-N |
| XLogP | 2.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|