C15H27IO4Si — CID 10693697
ethyl (2E,5S,6E)-7-iodo-5-(2-trimethylsilylethoxymethoxy)hepta-2,6-dienoate (PubChem CID 10693697) has the molecular formula C15H27IO4Si and a molecular weight of 426.37 g/mol. Its IUPAC name is ethyl (2E,5S,6E)-7-iodo-5-(2-trimethylsilylethoxymethoxy)hepta-2,6-dienoate.
| Compound Name | ethyl (2E,5S,6E)-7-iodo-5-(2-trimethylsilylethoxymethoxy)hepta-2,6-dienoate |
|---|---|
| PubChem CID | 10693697 |
| Molecular Formula | C15H27IO4Si |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | ethyl (2E,5S,6E)-7-iodo-5-(2-trimethylsilylethoxymethoxy)hepta-2,6-dienoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](/C=C/I)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C15H27IO4Si/c1-5-19-15(17)8-6-7-14(9-10-16)20-13-18-11-12-21(2,3)4/h6,8-10,14H,5,7,11-13H2,1-4H3/b8-6+,10-9+/t14-/m0/s1 |
| InChIKey | BLSNAEJNGQRWPF-BORXFJDCSA-N |
| XLogP | 4.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|