C9H20O4Si — CID 10775311
(2R)-2-(2-trimethylsilylethoxymethoxy)propanoic acid (PubChem CID 10775311) has the molecular formula C9H20O4Si and a molecular weight of 220.34 g/mol. Its IUPAC name is (2R)-2-(2-trimethylsilylethoxymethoxy)propanoic acid.
| Compound Name | (2R)-2-(2-trimethylsilylethoxymethoxy)propanoic acid |
|---|---|
| PubChem CID | 10775311 |
| Molecular Formula | C9H20O4Si |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (2R)-2-(2-trimethylsilylethoxymethoxy)propanoic acid |
| SMILES | C[C@@H](OCOCC[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C9H20O4Si/c1-8(9(10)11)13-7-12-5-6-14(2,3)4/h8H,5-7H2,1-4H3,(H,10,11)/t8-/m1/s1 |
| InChIKey | KNYIOTKZTBKTMT-MRVPVSSYSA-N |
| XLogP | 1.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|