C14H31NO4Si — CID 87972756
(2S)-2-[[(2R)-3-methyl-2-(2-trimethylsilylethoxymethoxy)butyl]amino]propanoic acid (PubChem CID 87972756) has the molecular formula C14H31NO4Si and a molecular weight of 305.49 g/mol. Its IUPAC name is (2S)-2-[[(2R)-3-methyl-2-(2-trimethylsilylethoxymethoxy)butyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2R)-3-methyl-2-(2-trimethylsilylethoxymethoxy)butyl]amino]propanoic acid |
|---|---|
| PubChem CID | 87972756 |
| Molecular Formula | C14H31NO4Si |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (2S)-2-[[(2R)-3-methyl-2-(2-trimethylsilylethoxymethoxy)butyl]amino]propanoic acid |
| SMILES | CC(C)[C@H](CN[C@@H](C)C(=O)O)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C14H31NO4Si/c1-11(2)13(9-15-12(3)14(16)17)19-10-18-7-8-20(4,5)6/h11-13,15H,7-10H2,1-6H3,(H,16,17)/t12-,13-/m0/s1 |
| InChIKey | CKZQSJGGRIRPOU-STQMWFEESA-N |
| XLogP | 2.40 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|