C16H23F3O5Si — CID 124672506
(2S)-2-[4-(2,2-difluoroethoxy)-2-fluorophenyl]-2-(2-trimethylsilylethoxymethoxy)acetic acid (PubChem CID 124672506) has the molecular formula C16H23F3O5Si and a molecular weight of 380.44 g/mol. Its IUPAC name is (2S)-2-[4-(2,2-difluoroethoxy)-2-fluorophenyl]-2-(2-trimethylsilylethoxymethoxy)acetic acid.
| Compound Name | (2S)-2-[4-(2,2-difluoroethoxy)-2-fluorophenyl]-2-(2-trimethylsilylethoxymethoxy)acetic acid |
|---|---|
| PubChem CID | 124672506 |
| Molecular Formula | C16H23F3O5Si |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (2S)-2-[4-(2,2-difluoroethoxy)-2-fluorophenyl]-2-(2-trimethylsilylethoxymethoxy)acetic acid |
| SMILES | C[Si](C)(C)CCOCO[C@H](C(=O)O)c1ccc(OCC(F)F)cc1F |
| InChI | InChI=1S/C16H23F3O5Si/c1-25(2,3)7-6-22-10-24-15(16(20)21)12-5-4-11(8-13(12)17)23-9-14(18)19/h4-5,8,14-15H,6-7,9-10H2,1-3H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | JFHXJUTZMDGJOY-HNNXBMFYSA-N |
| XLogP | 3.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|