C16H24F2O5Si — CID 88592938
2-[2-fluoro-4-(2-fluoroethoxy)phenyl]-2-(2-trimethylsilylethoxymethoxy)acetic acid (PubChem CID 88592938) has the molecular formula C16H24F2O5Si and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[2-fluoro-4-(2-fluoroethoxy)phenyl]-2-(2-trimethylsilylethoxymethoxy)acetic acid.
| Compound Name | 2-[2-fluoro-4-(2-fluoroethoxy)phenyl]-2-(2-trimethylsilylethoxymethoxy)acetic acid |
|---|---|
| PubChem CID | 88592938 |
| Molecular Formula | C16H24F2O5Si |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[2-fluoro-4-(2-fluoroethoxy)phenyl]-2-(2-trimethylsilylethoxymethoxy)acetic acid |
| SMILES | C[Si](C)(C)CCOCOC(C(=O)O)c1ccc(OCCF)cc1F |
| InChI | InChI=1S/C16H24F2O5Si/c1-24(2,3)9-8-21-11-23-15(16(19)20)13-5-4-12(10-14(13)18)22-7-6-17/h4-5,10,15H,6-9,11H2,1-3H3,(H,19,20) |
| InChIKey | AJJVBZCMHBOOCF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|