C28H38O6Si — CID 10696666
[(1S,4R)-3-methylidene-1-phenyl-4-(2-trimethylsilylethoxymethoxy)pentyl] (2S)-2-acetyloxy-2-phenylacetate (PubChem CID 10696666) has the molecular formula C28H38O6Si and a molecular weight of 498.69 g/mol. Its IUPAC name is [(1S,4R)-3-methylidene-1-phenyl-4-(2-trimethylsilylethoxymethoxy)pentyl] (2S)-2-acetyloxy-2-phenylacetate.
| Compound Name | [(1S,4R)-3-methylidene-1-phenyl-4-(2-trimethylsilylethoxymethoxy)pentyl] (2S)-2-acetyloxy-2-phenylacetate |
|---|---|
| PubChem CID | 10696666 |
| Molecular Formula | C28H38O6Si |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [(1S,4R)-3-methylidene-1-phenyl-4-(2-trimethylsilylethoxymethoxy)pentyl] (2S)-2-acetyloxy-2-phenylacetate |
| SMILES | C=C(C[C@H](OC(=O)[C@@H](OC(C)=O)c1ccccc1)c1ccccc1)[C@@H](C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C28H38O6Si/c1-21(22(2)32-20-31-17-18-35(4,5)6)19-26(24-13-9-7-10-14-24)34-28(30)27(33-23(3)29)25-15-11-8-12-16-25/h7-16,22,26-27H,1,17-20H2,2-6H3/t22-,26+,27+/m1/s1 |
| InChIKey | IZYGAYSKIGJGHW-ICTDUYRTSA-N |
| XLogP | 6.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|