C23H36O5Si — CID 100931159
[(3R,5Z,7R)-7-(2-trimethylsilylethoxymethoxy)octa-1,5-dien-3-yl] 2-phenylmethoxyacetate (PubChem CID 100931159) has the molecular formula C23H36O5Si and a molecular weight of 420.62 g/mol. Its IUPAC name is [(3R,5Z,7R)-7-(2-trimethylsilylethoxymethoxy)octa-1,5-dien-3-yl] 2-phenylmethoxyacetate.
| Compound Name | [(3R,5Z,7R)-7-(2-trimethylsilylethoxymethoxy)octa-1,5-dien-3-yl] 2-phenylmethoxyacetate |
|---|---|
| PubChem CID | 100931159 |
| Molecular Formula | C23H36O5Si |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | [(3R,5Z,7R)-7-(2-trimethylsilylethoxymethoxy)octa-1,5-dien-3-yl] 2-phenylmethoxyacetate |
| SMILES | C=C[C@@H](C/C=C\[C@@H](C)OCOCC[Si](C)(C)C)OC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C23H36O5Si/c1-6-22(28-23(24)18-26-17-21-12-8-7-9-13-21)14-10-11-20(2)27-19-25-15-16-29(3,4)5/h6-13,20,22H,1,14-19H2,2-5H3/b11-10-/t20-,22+/m1/s1 |
| InChIKey | AZBGHIFRNOYVGQ-MLXJMKKPSA-N |
| XLogP | 4.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|